C20H27FN4O2 — CID 132777867
3-[[[4-(2-fluoroethoxy)phenyl]methyl-methylamino]methyl]-1-pyrazin-2-ylpiperidin-3-ol (PubChem CID 132777867) has the molecular formula C20H27FN4O2 and a molecular weight of 374.46 g/mol. Its IUPAC name is 3-[[[4-(2-fluoroethoxy)phenyl]methyl-methylamino]methyl]-1-pyrazin-2-ylpiperidin-3-ol.
| Compound Name | 3-[[[4-(2-fluoroethoxy)phenyl]methyl-methylamino]methyl]-1-pyrazin-2-ylpiperidin-3-ol |
|---|---|
| PubChem CID | 132777867 |
| Molecular Formula | C20H27FN4O2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 3-[[[4-(2-fluoroethoxy)phenyl]methyl-methylamino]methyl]-1-pyrazin-2-ylpiperidin-3-ol |
| SMILES | CN(Cc1ccc(OCCF)cc1)CC1(O)CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C20H27FN4O2/c1-24(14-17-3-5-18(6-4-17)27-12-8-21)15-20(26)7-2-11-25(16-20)19-13-22-9-10-23-19/h3-6,9-10,13,26H,2,7-8,11-12,14-16H2,1H3 |
| InChIKey | MRDJQYJULGZLAP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |