C22H33N5O4 — CID 129456919
(3R)-3-[[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methylamino]methyl]-1-[6-(methylamino)pyrimidin-4-yl]piperidin-3-ol (PubChem CID 129456919) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is (3R)-3-[[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methylamino]methyl]-1-[6-(methylamino)pyrimidin-4-yl]piperidin-3-ol.
| Compound Name | (3R)-3-[[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methylamino]methyl]-1-[6-(methylamino)pyrimidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 129456919 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (3R)-3-[[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methylamino]methyl]-1-[6-(methylamino)pyrimidin-4-yl]piperidin-3-ol |
| SMILES | CNc1cc(N2CCC[C@@](O)(CNCc3ccc(OCCOCCO)cc3)C2)ncn1 |
| InChI | InChI=1S/C22H33N5O4/c1-23-20-13-21(26-17-25-20)27-8-2-7-22(29,16-27)15-24-14-18-3-5-19(6-4-18)31-12-11-30-10-9-28/h3-6,13,17,24,28-29H,2,7-12,14-16H2,1H3,(H,23,25,26)/t22-/m1/s1 |
| InChIKey | NLYJSXFVRLVTFZ-JOCHJYFZSA-N |
| XLogP | 1.03 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|