C26H31N3O3 — CID 129457151
(2S)-N-(4-imidazol-1-ylbutyl)-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide (PubChem CID 129457151) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is (2S)-N-(4-imidazol-1-ylbutyl)-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-(4-imidazol-1-ylbutyl)-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 129457151 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (2S)-N-(4-imidazol-1-ylbutyl)-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide |
| SMILES | COc1ccccc1-c1cccc(C[C@]2(C(=O)NCCCCn3ccnc3)CCCO2)c1 |
| InChI | InChI=1S/C26H31N3O3/c1-31-24-11-3-2-10-23(24)22-9-6-8-21(18-22)19-26(12-7-17-32-26)25(30)28-13-4-5-15-29-16-14-27-20-29/h2-3,6,8-11,14,16,18,20H,4-5,7,12-13,15,17,19H2,1H3,(H,28,30)/t26-/m0/s1 |
| InChIKey | OHJBTQKTUMGADF-SANMLTNESA-N |
| XLogP | 4.25 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|