C28H39N3O3 — CID 129456579
(2S)-N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide (PubChem CID 129456579) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is (2S)-N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 129456579 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | (2S)-N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)[C@@]2(Cc3cccc(-c4ccccc4OC)c3)CCCO2)CC1 |
| InChI | InChI=1S/C28H39N3O3/c1-3-30-16-18-31(19-17-30)15-8-14-29-27(32)28(13-7-20-34-28)22-23-9-6-10-24(21-23)25-11-4-5-12-26(25)33-2/h4-6,9-12,21H,3,7-8,13-20,22H2,1-2H3,(H,29,32)/t28-/m0/s1 |
| InChIKey | MHGWVIMGSOTZLU-NDEPHWFRSA-N |
| XLogP | 3.60 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|