C28H37FN2O3 — CID 129455270
(2S)-2-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]-N-[3-(4-methylpiperidin-1-yl)propyl]oxolane-2-carboxamide (PubChem CID 129455270) has the molecular formula C28H37FN2O3 and a molecular weight of 468.61 g/mol. Its IUPAC name is (2S)-2-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]-N-[3-(4-methylpiperidin-1-yl)propyl]oxolane-2-carboxamide.
| Compound Name | (2S)-2-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]-N-[3-(4-methylpiperidin-1-yl)propyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 129455270 |
| Molecular Formula | C28H37FN2O3 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | (2S)-2-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]-N-[3-(4-methylpiperidin-1-yl)propyl]oxolane-2-carboxamide |
| SMILES | COc1ccc(F)cc1-c1ccc(C[C@]2(C(=O)NCCCN3CCC(C)CC3)CCCO2)cc1 |
| InChI | InChI=1S/C28H37FN2O3/c1-21-11-16-31(17-12-21)15-4-14-30-27(32)28(13-3-18-34-28)20-22-5-7-23(8-6-22)25-19-24(29)9-10-26(25)33-2/h5-10,19,21H,3-4,11-18,20H2,1-2H3,(H,30,32)/t28-/m0/s1 |
| InChIKey | HTEZQVXUZILJQR-NDEPHWFRSA-N |
| XLogP | 4.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|