C23H28N2O4 — CID 124970605
(2S)-N-(2-acetamidoethyl)-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide (PubChem CID 124970605) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2S)-N-(2-acetamidoethyl)-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-(2-acetamidoethyl)-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 124970605 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (2S)-N-(2-acetamidoethyl)-2-[[3-(2-methoxyphenyl)phenyl]methyl]oxolane-2-carboxamide |
| SMILES | COc1ccccc1-c1cccc(C[C@]2(C(=O)NCCNC(C)=O)CCCO2)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-17(26)24-12-13-25-22(27)23(11-6-14-29-23)16-18-7-5-8-19(15-18)20-9-3-4-10-21(20)28-2/h3-5,7-10,15H,6,11-14,16H2,1-2H3,(H,24,26)(H,25,27)/t23-/m0/s1 |
| InChIKey | JRDXNYIWCJIXDL-QHCPKHFHSA-N |
| XLogP | 2.71 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|