About [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol
[(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol (PubChem CID 129462864) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol |
| PubChem CID | 129462864 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol |
| SMILES | CN1C[C@H](CO)CC1(C)C |
| InChI | InChI=1S/C8H17NO/c1-8(2)4-7(6-10)5-9(8)3/h7,10H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | CHBISKAQNIJREV-SSDOTTSWSA-N |
| XLogP | 0.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol?
The IUPAC name of [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol (CID 129462864) is [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol?
The canonical SMILES for [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol is CN1C[C@H](CO)CC1(C)C.
What is the InChIKey of [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol?
The InChIKey is CHBISKAQNIJREV-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H17NO/c1-8(2)4-7(6-10)5-9(8)3/h7,10H,4-6H2,1-3H3/t7-/m1/s1.
What are the key properties of [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol?
[(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol has a molecular weight of 143.23 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1,5,5-trimethylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 129462864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).