C18H26N2O4S — CID 129468894
2-[acetyl-[(4S)-1-(4-thiophen-2-ylbutanoyl)azepan-4-yl]amino]acetic acid (PubChem CID 129468894) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 2-[acetyl-[(4S)-1-(4-thiophen-2-ylbutanoyl)azepan-4-yl]amino]acetic acid.
| Compound Name | 2-[acetyl-[(4S)-1-(4-thiophen-2-ylbutanoyl)azepan-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 129468894 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[acetyl-[(4S)-1-(4-thiophen-2-ylbutanoyl)azepan-4-yl]amino]acetic acid |
| SMILES | CC(=O)N(CC(=O)O)[C@H]1CCCN(C(=O)CCCc2cccs2)CC1 |
| InChI | InChI=1S/C18H26N2O4S/c1-14(21)20(13-18(23)24)15-5-3-10-19(11-9-15)17(22)8-2-6-16-7-4-12-25-16/h4,7,12,15H,2-3,5-6,8-11,13H2,1H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | WWHBCZFAGJPEFC-HNNXBMFYSA-N |
| XLogP | 2.38 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |