C15H19N3O2 — CID 129470949
4-[2-(2,3-dihydroindol-1-yl)acetyl]-1-methylpiperazin-2-one (PubChem CID 129470949) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[2-(2,3-dihydroindol-1-yl)acetyl]-1-methylpiperazin-2-one.
| Compound Name | 4-[2-(2,3-dihydroindol-1-yl)acetyl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 129470949 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[2-(2,3-dihydroindol-1-yl)acetyl]-1-methylpiperazin-2-one |
| SMILES | CN1CCN(C(=O)CN2CCc3ccccc32)CC1=O |
| InChI | InChI=1S/C15H19N3O2/c1-16-8-9-18(10-14(16)19)15(20)11-17-7-6-12-4-2-3-5-13(12)17/h2-5H,6-11H2,1H3 |
| InChIKey | TWUBPLKSXINRTE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |