C21H29N3O — CID 129476025
(4R)-1-[(2-methoxyphenyl)methyl]-N-methyl-N-(pyridin-2-ylmethyl)azepan-4-amine (PubChem CID 129476025) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (4R)-1-[(2-methoxyphenyl)methyl]-N-methyl-N-(pyridin-2-ylmethyl)azepan-4-amine.
| Compound Name | (4R)-1-[(2-methoxyphenyl)methyl]-N-methyl-N-(pyridin-2-ylmethyl)azepan-4-amine |
|---|---|
| PubChem CID | 129476025 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (4R)-1-[(2-methoxyphenyl)methyl]-N-methyl-N-(pyridin-2-ylmethyl)azepan-4-amine |
| SMILES | COc1ccccc1CN1CCC[C@@H](N(C)Cc2ccccn2)CC1 |
| InChI | InChI=1S/C21H29N3O/c1-23(17-19-9-5-6-13-22-19)20-10-7-14-24(15-12-20)16-18-8-3-4-11-21(18)25-2/h3-6,8-9,11,13,20H,7,10,12,14-17H2,1-2H3/t20-/m1/s1 |
| InChIKey | NNSDBTDZZKXWQN-HXUWFJFHSA-N |
| XLogP | 3.58 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |