C19H24N4S — CID 129002543
5-[[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]methyl]thiophene-3-carbonitrile (PubChem CID 129002543) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is 5-[[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 129002543 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 5-[[4-[methyl(pyridin-2-ylmethyl)amino]azepan-1-yl]methyl]thiophene-3-carbonitrile |
| SMILES | CN(Cc1ccccn1)C1CCCN(Cc2cc(C#N)cs2)CC1 |
| InChI | InChI=1S/C19H24N4S/c1-22(13-17-5-2-3-8-21-17)18-6-4-9-23(10-7-18)14-19-11-16(12-20)15-24-19/h2-3,5,8,11,15,18H,4,6-7,9-10,13-14H2,1H3 |
| InChIKey | GTIURDAKDIUGJC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |