C14H20N4O3 — CID 129477090
2-[[(2S)-4-[(5-cyanofuran-2-yl)methyl]morpholin-2-yl]methyl-methylamino]acetamide (PubChem CID 129477090) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-[[(2S)-4-[(5-cyanofuran-2-yl)methyl]morpholin-2-yl]methyl-methylamino]acetamide.
| Compound Name | 2-[[(2S)-4-[(5-cyanofuran-2-yl)methyl]morpholin-2-yl]methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 129477090 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-[[(2S)-4-[(5-cyanofuran-2-yl)methyl]morpholin-2-yl]methyl-methylamino]acetamide |
| SMILES | CN(CC(N)=O)C[C@H]1CN(Cc2ccc(C#N)o2)CCO1 |
| InChI | InChI=1S/C14H20N4O3/c1-17(10-14(16)19)7-13-9-18(4-5-20-13)8-12-3-2-11(6-15)21-12/h2-3,13H,4-5,7-10H2,1H3,(H2,16,19)/t13-/m0/s1 |
| InChIKey | YLRPOHMBTDDIQY-ZDUSSCGKSA-N |
| XLogP | -0.23 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |