C18H18F3N3O2S — CID 129481169
(3R)-3-methyl-N-[4-methyl-5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-yl]-6-oxopiperidine-3-carboxamide (PubChem CID 129481169) has the molecular formula C18H18F3N3O2S and a molecular weight of 397.42 g/mol. Its IUPAC name is (3R)-3-methyl-N-[4-methyl-5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-yl]-6-oxopiperidine-3-carboxamide.
| Compound Name | (3R)-3-methyl-N-[4-methyl-5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-yl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 129481169 |
| Molecular Formula | C18H18F3N3O2S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (3R)-3-methyl-N-[4-methyl-5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-yl]-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1nc(NC(=O)[C@]2(C)CCC(=O)NC2)sc1Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H18F3N3O2S/c1-9-12(7-10-3-4-11(19)15(21)14(10)20)27-17(23-9)24-16(26)18(2)6-5-13(25)22-8-18/h3-4H,5-8H2,1-2H3,(H,22,25)(H,23,24,26)/t18-/m1/s1 |
| InChIKey | QHVOOQREHVENGS-GOSISDBHSA-N |
| XLogP | 3.31 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|