C12H14IN3O2 — CID 167827365
N-(3-iodo-4-pyridinyl)-3-methyl-6-oxopiperidine-3-carboxamide (PubChem CID 167827365) has the molecular formula C12H14IN3O2 and a molecular weight of 359.17 g/mol. Its IUPAC name is N-(3-iodo-4-pyridinyl)-3-methyl-6-oxopiperidine-3-carboxamide.
| Compound Name | N-(3-iodo-4-pyridinyl)-3-methyl-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 167827365 |
| Molecular Formula | C12H14IN3O2 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | N-(3-iodo-4-pyridinyl)-3-methyl-6-oxopiperidine-3-carboxamide |
| SMILES | CC1(C(=O)Nc2ccncc2I)CCC(=O)NC1 |
| InChI | InChI=1S/C12H14IN3O2/c1-12(4-2-10(17)15-7-12)11(18)16-9-3-5-14-6-8(9)13/h3,5-6H,2,4,7H2,1H3,(H,15,17)(H,14,16,18) |
| InChIKey | BZPHNKKMARTEDP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|