C8H10IN3O — CID 131102258
3-(3-iodo-4-pyridinyl)-1,1-dimethylurea (PubChem CID 131102258) has the molecular formula C8H10IN3O and a molecular weight of 291.09 g/mol. Its IUPAC name is 3-(3-iodo-4-pyridinyl)-1,1-dimethylurea.
| Compound Name | 3-(3-iodo-4-pyridinyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 131102258 |
| Molecular Formula | C8H10IN3O |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 3-(3-iodo-4-pyridinyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccncc1I |
| InChI | InChI=1S/C8H10IN3O/c1-12(2)8(13)11-7-3-4-10-5-6(7)9/h3-5H,1-2H3,(H,10,11,13) |
| InChIKey | PTCIIQDJSVLYLM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|