C19H24N6O — CID 129483872
(1S)-1-(1-methylimidazol-2-yl)-1-(oxan-4-yl)-N-[(2-phenyltriazol-4-yl)methyl]methanamine (PubChem CID 129483872) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is (1S)-1-(1-methylimidazol-2-yl)-1-(oxan-4-yl)-N-[(2-phenyltriazol-4-yl)methyl]methanamine.
| Compound Name | (1S)-1-(1-methylimidazol-2-yl)-1-(oxan-4-yl)-N-[(2-phenyltriazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 129483872 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (1S)-1-(1-methylimidazol-2-yl)-1-(oxan-4-yl)-N-[(2-phenyltriazol-4-yl)methyl]methanamine |
| SMILES | Cn1ccnc1[C@@H](NCc1cnn(-c2ccccc2)n1)C1CCOCC1 |
| InChI | InChI=1S/C19H24N6O/c1-24-10-9-20-19(24)18(15-7-11-26-12-8-15)21-13-16-14-22-25(23-16)17-5-3-2-4-6-17/h2-6,9-10,14-15,18,21H,7-8,11-13H2,1H3/t18-/m0/s1 |
| InChIKey | OEDLXSBCEWIIMJ-SFHVURJKSA-N |
| XLogP | 2.26 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |