C16H17N5O — CID 56916869
4-[[2-(oxolan-3-yl)imidazol-1-yl]methyl]-2-phenyltriazole (PubChem CID 56916869) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-[[2-(oxolan-3-yl)imidazol-1-yl]methyl]-2-phenyltriazole.
| Compound Name | 4-[[2-(oxolan-3-yl)imidazol-1-yl]methyl]-2-phenyltriazole |
|---|---|
| PubChem CID | 56916869 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-[[2-(oxolan-3-yl)imidazol-1-yl]methyl]-2-phenyltriazole |
| SMILES | c1ccc(-n2ncc(Cn3ccnc3C3CCOC3)n2)cc1 |
| InChI | InChI=1S/C16H17N5O/c1-2-4-15(5-3-1)21-18-10-14(19-21)11-20-8-7-17-16(20)13-6-9-22-12-13/h1-5,7-8,10,13H,6,9,11-12H2 |
| InChIKey | XQYLZYNQIFPSGV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |