About (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide
(3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide (PubChem CID 129485088) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide.
Molecular Properties
| Compound Name | (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide |
| PubChem CID | 129485088 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide |
| SMILES | CC(=O)N1CCC[C@](O)(C(=O)NCCC2Cc3ccccc3C2)C1 |
| InChI | InChI=1S/C19H26N2O3/c1-14(22)21-10-4-8-19(24,13-21)18(23)20-9-7-15-11-16-5-2-3-6-17(16)12-15/h2-3,5-6,15,24H,4,7-13H2,1H3,(H,20,23)/t19-/m1/s1 |
| InChIKey | WRYBWCIJRUPOOX-LJQANCHMSA-N |
| XLogP | 1.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide?
The IUPAC name of (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide (CID 129485088) is (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide.
What is the SMILES notation for (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide?
The canonical SMILES for (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide is CC(=O)N1CCC[C@](O)(C(=O)NCCC2Cc3ccccc3C2)C1.
What is the InChIKey of (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide?
The InChIKey is WRYBWCIJRUPOOX-LJQANCHMSA-N. The full InChI is InChI=1S/C19H26N2O3/c1-14(22)21-10-4-8-19(24,13-21)18(23)20-9-7-15-11-16-5-2-3-6-17(16)12-15/h2-3,5-6,15,24H,4,7-13H2,1H3,(H,20,23)/t19-/m1/s1.
What are the key properties of (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide?
(3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide has a molecular weight of 330.43 g/mol, XLogP of 1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-acetyl-N-[2-(2,3-dihydro-1H-inden-2-yl)ethyl]-3-hydroxypiperidine-3-carboxamide is sourced from PubChem (CID 129485088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).