C12H12N2O2 — CID 129499040
(5R)-5-(aminomethyl)-3-(4-ethynylphenyl)-1,3-oxazolidin-2-one (PubChem CID 129499040) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is (5R)-5-(aminomethyl)-3-(4-ethynylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(aminomethyl)-3-(4-ethynylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 129499040 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (5R)-5-(aminomethyl)-3-(4-ethynylphenyl)-1,3-oxazolidin-2-one |
| SMILES | C#Cc1ccc(N2C[C@@H](CN)OC2=O)cc1 |
| InChI | InChI=1S/C12H12N2O2/c1-2-9-3-5-10(6-4-9)14-8-11(7-13)16-12(14)15/h1,3-6,11H,7-8,13H2/t11-/m1/s1 |
| InChIKey | HYAURGWUJQZHBK-LLVKDONJSA-N |
| XLogP | 0.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|