C12H13BrN2O2 — CID 129499398
(3S)-3-(4-bromophenyl)-1,4-dimethylpiperazine-2,5-dione (PubChem CID 129499398) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is (3S)-3-(4-bromophenyl)-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | (3S)-3-(4-bromophenyl)-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 129499398 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (3S)-3-(4-bromophenyl)-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N(C)[C@@H](c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C12H13BrN2O2/c1-14-7-10(16)15(2)11(12(14)17)8-3-5-9(13)6-4-8/h3-6,11H,7H2,1-2H3/t11-/m0/s1 |
| InChIKey | JKDTWQWCSPGCGX-NSHDSACASA-N |
| XLogP | 1.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |