About 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione
3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione (PubChem CID 121207871) has the molecular formula C12H13BrN2O2
and a molecular weight of 297.15 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione |
| PubChem CID | 121207871 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N(C)C(c2ccccc2Br)C1=O |
| InChI | InChI=1S/C12H13BrN2O2/c1-14-7-10(16)15(2)11(12(14)17)8-5-3-4-6-9(8)13/h3-6,11H,7H2,1-2H3 |
| InChIKey | GKJHPNFVYDLORT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione?
The IUPAC name of 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione (CID 121207871) is 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione.
What is the SMILES notation for 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione?
The canonical SMILES for 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione is CN1CC(=O)N(C)C(c2ccccc2Br)C1=O.
What is the InChIKey of 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione?
The InChIKey is GKJHPNFVYDLORT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2O2/c1-14-7-10(16)15(2)11(12(14)17)8-5-3-4-6-9(8)13/h3-6,11H,7H2,1-2H3.
What are the key properties of 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione?
3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione has a molecular weight of 297.15 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromophenyl)-1,4-dimethylpiperazine-2,5-dione is sourced from PubChem (CID 121207871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).