C10H10BrNOS — CID 175252301
4-(4-bromophenyl)-3-methyl-1,3-thiazolidin-2-one (PubChem CID 175252301) has the molecular formula C10H10BrNOS and a molecular weight of 272.17 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-methyl-1,3-thiazolidin-2-one.
| Compound Name | 4-(4-bromophenyl)-3-methyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 175252301 |
| Molecular Formula | C10H10BrNOS |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 4-(4-bromophenyl)-3-methyl-1,3-thiazolidin-2-one |
| SMILES | CN1C(=O)SCC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H10BrNOS/c1-12-9(6-14-10(12)13)7-2-4-8(11)5-3-7/h2-5,9H,6H2,1H3 |
| InChIKey | MGXBLMMIGHQKLA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|