C12H12LiN — CID 12956553
lithium N,N-dimethyl-8H-naphthalen-8-id-1-amine (PubChem CID 12956553) has the molecular formula C12H12LiN and a molecular weight of 177.18 g/mol. Its IUPAC name is lithium N,N-dimethyl-8H-naphthalen-8-id-1-amine.
| Compound Name | lithium N,N-dimethyl-8H-naphthalen-8-id-1-amine |
|---|---|
| PubChem CID | 12956553 |
| Molecular Formula | C12H12LiN |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | lithium N,N-dimethyl-8H-naphthalen-8-id-1-amine |
| SMILES | CN(C)c1cccc2ccc[c-]c12.[Li+] |
| InChI | InChI=1S/C12H12N.Li/c1-13(2)12-9-5-7-10-6-3-4-8-11(10)12;/h3-7,9H,1-2H3;/q-1;+1 |
| InChIKey | XACDMGHZYVNSAG-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|