C11H13NO2 — CID 12958742
2,3-bis[(Z)-prop-1-enoxy]pyridine (PubChem CID 12958742) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2,3-bis[(Z)-prop-1-enoxy]pyridine.
| Compound Name | 2,3-bis[(Z)-prop-1-enoxy]pyridine |
|---|---|
| PubChem CID | 12958742 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2,3-bis[(Z)-prop-1-enoxy]pyridine |
| SMILES | C/C=C\Oc1cccnc1O/C=C\C |
| InChI | InChI=1S/C11H13NO2/c1-3-8-13-10-6-5-7-12-11(10)14-9-4-2/h3-9H,1-2H3/b8-3-,9-4- |
| InChIKey | IIDLBNKGYXXQET-ZATFKQDHSA-N |
| XLogP | 2.91 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|