C66H72N4O2 — CID 12964572
5-N,8-N-bis[4-[1-(4-amino-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenyl]-1,12-dimethylbenzo[c]phenanthrene-5,8-dicarboxamide (PubChem CID 12964572) has the molecular formula C66H72N4O2 and a molecular weight of 953.33 g/mol. Its IUPAC name is 5-N,8-N-bis[4-[1-(4-amino-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenyl]-1,12-dimethylbenzo[c]phenanthrene-5,8-dicarboxamide.
| Compound Name | 5-N,8-N-bis[4-[1-(4-amino-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenyl]-1,12-dimethylbenzo[c]phenanthrene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 12964572 |
| Molecular Formula | C66H72N4O2 |
| Molecular Weight | 953.33 g/mol |
| Exact Mass | 952.57 |
| IUPAC Name | 5-N,8-N-bis[4-[1-(4-amino-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenyl]-1,12-dimethylbenzo[c]phenanthrene-5,8-dicarboxamide |
| SMILES | Cc1cc(C2(c3cc(C)c(NC(=O)c4cc5cc(C(=O)Nc6c(C)cc(C7(c8cc(C)c(N)c(C)c8)CCCCC7)cc6C)c6cccc(C)c6c5c5c(C)cccc45)c(C)c3)CCCCC2)cc(C)c1N |
| InChI | InChI=1S/C66H72N4O2/c1-37-19-17-21-52-54(63(71)69-61-43(7)31-50(32-44(61)8)65(23-13-11-14-24-65)48-27-39(3)59(67)40(4)28-48)35-47-36-55(53-22-18-20-38(2)57(53)58(47)56(37)52)64(72)70-62-45(9)33-51(34-46(62)10)66(25-15-12-16-26-66)49-29-41(5)60(68)42(6)30-49/h17-22,27-36H,11-16,23-26,67-68H2,1-10H3,(H,69,71)(H,70,72) |
| InChIKey | YJACGDVSFDRJIF-UHFFFAOYSA-N |
| XLogP | 16.40 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.33 |
| LogP ≤ 5 | 16.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|