C14H22O6 — CID 12965310
(2S,3S,6R)-2-[2-[(2R,3R,6S)-3-hydroxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethyl]-6-methoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 12965310) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is (2S,3S,6R)-2-[2-[(2R,3R,6S)-3-hydroxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethyl]-6-methoxy-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2S,3S,6R)-2-[2-[(2R,3R,6S)-3-hydroxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethyl]-6-methoxy-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 12965310 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2S,3S,6R)-2-[2-[(2R,3R,6S)-3-hydroxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethyl]-6-methoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CO[C@H]1C=C[C@H](O)[C@H](CC[C@H]2O[C@H](OC)C=C[C@H]2O)O1 |
| InChI | InChI=1S/C14H22O6/c1-17-13-7-3-9(15)11(19-13)5-6-12-10(16)4-8-14(18-2)20-12/h3-4,7-16H,5-6H2,1-2H3/t9-,10+,11-,12+,13+,14- |
| InChIKey | CPCFTIMNOFZSGA-QSWPVVRKSA-N |
| XLogP | 0.34 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|