C16H24O3 — CID 12966867
ethyl 2-[(2R,3aR,6aS)-2,5,5-trimethyl-1-methylidene-3-oxo-3a,4,6,6a-tetrahydropentalen-2-yl]acetate (PubChem CID 12966867) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is ethyl 2-[(2R,3aR,6aS)-2,5,5-trimethyl-1-methylidene-3-oxo-3a,4,6,6a-tetrahydropentalen-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,3aR,6aS)-2,5,5-trimethyl-1-methylidene-3-oxo-3a,4,6,6a-tetrahydropentalen-2-yl]acetate |
|---|---|
| PubChem CID | 12966867 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | ethyl 2-[(2R,3aR,6aS)-2,5,5-trimethyl-1-methylidene-3-oxo-3a,4,6,6a-tetrahydropentalen-2-yl]acetate |
| SMILES | C=C1[C@H]2CC(C)(C)C[C@H]2C(=O)[C@]1(C)CC(=O)OCC |
| InChI | InChI=1S/C16H24O3/c1-6-19-13(17)9-16(5)10(2)11-7-15(3,4)8-12(11)14(16)18/h11-12H,2,6-9H2,1,3-5H3/t11-,12-,16-/m1/s1 |
| InChIKey | PKOICWHUOFEOCB-XHBSWPGZSA-N |
| XLogP | 3.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|