C15H22O2 — CID 14143762
ethyl 4-methylidenetricyclo[3.3.3.01,5]undecane-2-carboxylate (PubChem CID 14143762) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is ethyl 4-methylidenetricyclo[3.3.3.01,5]undecane-2-carboxylate.
| Compound Name | ethyl 4-methylidenetricyclo[3.3.3.01,5]undecane-2-carboxylate |
|---|---|
| PubChem CID | 14143762 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | ethyl 4-methylidenetricyclo[3.3.3.01,5]undecane-2-carboxylate |
| SMILES | C=C1CC(C(=O)OCC)C23CCCC12CCC3 |
| InChI | InChI=1S/C15H22O2/c1-3-17-13(16)12-10-11(2)14-6-4-8-15(12,14)9-5-7-14/h12H,2-10H2,1H3 |
| InChIKey | KAJDHZNKKVJALA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|