C19H28O6 — CID 138978749
triethyl (1R,3aS,6aS)-3a-methyl-3-methylidene-2,4,6,6a-tetrahydro-1H-pentalene-1,5,5-tricarboxylate (PubChem CID 138978749) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is triethyl (1R,3aS,6aS)-3a-methyl-3-methylidene-2,4,6,6a-tetrahydro-1H-pentalene-1,5,5-tricarboxylate.
| Compound Name | triethyl (1R,3aS,6aS)-3a-methyl-3-methylidene-2,4,6,6a-tetrahydro-1H-pentalene-1,5,5-tricarboxylate |
|---|---|
| PubChem CID | 138978749 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | triethyl (1R,3aS,6aS)-3a-methyl-3-methylidene-2,4,6,6a-tetrahydro-1H-pentalene-1,5,5-tricarboxylate |
| SMILES | C=C1C[C@@H](C(=O)OCC)[C@@H]2CC(C(=O)OCC)(C(=O)OCC)C[C@]12C |
| InChI | InChI=1S/C19H28O6/c1-6-23-15(20)13-9-12(4)18(5)11-19(10-14(13)18,16(21)24-7-2)17(22)25-8-3/h13-14H,4,6-11H2,1-3,5H3/t13-,14+,18-/m1/s1 |
| InChIKey | LXLPQXJGEOBFCU-QWQRMKEZSA-N |
| XLogP | 2.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|