C24H38O2 — CID 12967374
2-[(2R,5S)-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]prop-2-enal (PubChem CID 12967374) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is 2-[(2R,5S)-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]prop-2-enal.
| Compound Name | 2-[(2R,5S)-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 12967374 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 2-[(2R,5S)-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]prop-2-enal |
| SMILES | C=C(C=O)[C@H]1CC[C@H](CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CO1 |
| InChI | InChI=1S/C24H38O2/c1-19(2)9-6-10-20(3)11-7-12-21(4)13-8-14-23-15-16-24(26-18-23)22(5)17-25/h9,11,13,17,23-24H,5-8,10,12,14-16,18H2,1-4H3/b20-11+,21-13+/t23-,24+/m0/s1 |
| InChIKey | RDMWIOZONHPHBG-ARDDFUAWSA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|