C26H42O3 — CID 15346606
ethyl 2-[5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]prop-2-enoate (PubChem CID 15346606) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is ethyl 2-[5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]prop-2-enoate.
| Compound Name | ethyl 2-[5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 15346606 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | ethyl 2-[5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)C1CCC(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CO1 |
| InChI | InChI=1S/C26H42O3/c1-7-28-26(27)23(6)25-18-17-24(19-29-25)16-10-15-22(5)14-9-13-21(4)12-8-11-20(2)3/h11,13,15,24-25H,6-10,12,14,16-19H2,1-5H3/b21-13+,22-15+ |
| InChIKey | IDVVGYJYSFTPRP-NTZRDTQNSA-N |
| XLogP | 7.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|