C21H38O5Si — CID 12967613
[(1R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2,2-dimethylpropanoyloxy)cyclopent-2-en-1-yl] 2,2-dimethylpropanoate (PubChem CID 12967613) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is [(1R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2,2-dimethylpropanoyloxy)cyclopent-2-en-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2,2-dimethylpropanoyloxy)cyclopent-2-en-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 12967613 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [(1R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2,2-dimethylpropanoyloxy)cyclopent-2-en-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1C=C[C@@H](OC(=O)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O5Si/c1-19(2,3)17(22)24-14-12-13-15(25-18(23)20(4,5)6)16(14)26-27(10,11)21(7,8)9/h12-16H,1-11H3/t14-,15+,16? |
| InChIKey | UCCJRVIVUHNXQA-XYPWUTKMSA-N |
| XLogP | 4.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|