About 9h-Pyrido (3,4)-indole
9h-Pyrido (3,4)-indole (PubChem CID 129717795) has the molecular formula C11H8N2
and a molecular weight of 168.19 g/mol. Its IUPAC name is 9H-pyrrolo[2,3-f]isoquinoline.
Molecular Properties
| Compound Name | 9h-Pyrido (3,4)-indole |
| PubChem CID | 129717795 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 9H-pyrrolo[2,3-f]isoquinoline |
| SMILES | C1C=NC=C2C1=C3C(=CC=N3)C=C2 |
| InChI | InChI=1S/C11H8N2/c1-2-9-7-12-5-4-10(9)11-8(1)3-6-13-11/h1-3,5-7H,4H2 |
| InChIKey | ZHJYTAVMFPBNRW-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 24.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | 443 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9h-Pyrido (3,4)-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9h-Pyrido (3,4)-indole?
The IUPAC name of 9h-Pyrido (3,4)-indole (CID 129717795) is 9H-pyrrolo[2,3-f]isoquinoline.
What is the SMILES notation for 9h-Pyrido (3,4)-indole?
The canonical SMILES for 9h-Pyrido (3,4)-indole is C1C=NC=C2C1=C3C(=CC=N3)C=C2.
What is the InChIKey of 9h-Pyrido (3,4)-indole?
The InChIKey is ZHJYTAVMFPBNRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2/c1-2-9-7-12-5-4-10(9)11-8(1)3-6-13-11/h1-3,5-7H,4H2.
What are the key properties of 9h-Pyrido (3,4)-indole?
9h-Pyrido (3,4)-indole has a molecular weight of 168.19 g/mol, XLogP of -0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9h-Pyrido (3,4)-indole is sourced from PubChem (CID 129717795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).