C20H15F12O2P — CID 12973328
2-[2-[1,1-dimethyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 12973328) has the molecular formula C20H15F12O2P and a molecular weight of 546.29 g/mol. Its IUPAC name is 2-[2-[1,1-dimethyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-[1,1-dimethyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 12973328 |
| Molecular Formula | C20H15F12O2P |
| Molecular Weight | 546.29 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | 2-[2-[1,1-dimethyl-3,3-bis(trifluoromethyl)-2,1λ5-benzoxaphosphol-1-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CP1(C)(c2ccccc2C(O)(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)(C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C20H15F12O2P/c1-35(2,13-9-5-3-7-11(13)15(33,17(21,22)23)18(24,25)26)14-10-6-4-8-12(14)16(34-35,19(27,28)29)20(30,31)32/h3-10,33H,1-2H3 |
| InChIKey | HUXYYYLJIWRCTD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.29 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|