C11H10FN3O2 — CID 12985697
4-(3-fluoroanilino)-1-methylpyrazole-5-carboxylic acid (PubChem CID 12985697) has the molecular formula C11H10FN3O2 and a molecular weight of 235.22 g/mol. Its IUPAC name is 4-(3-fluoroanilino)-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-(3-fluoroanilino)-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 12985697 |
| Molecular Formula | C11H10FN3O2 |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-(3-fluoroanilino)-1-methylpyrazole-5-carboxylic acid |
| SMILES | Cn1ncc(Nc2cccc(F)c2)c1C(=O)O |
| InChI | InChI=1S/C11H10FN3O2/c1-15-10(11(16)17)9(6-13-15)14-8-4-2-3-7(12)5-8/h2-6,14H,1H3,(H,16,17) |
| InChIKey | HTMCPJUUKOTIPZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |