C15H28O2Si — CID 12990077
tert-butyl-dimethyl-[(1S)-1-[(2R)-4-prop-1-en-2-yl-2,5-dihydrofuran-2-yl]ethoxy]silane (PubChem CID 12990077) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S)-1-[(2R)-4-prop-1-en-2-yl-2,5-dihydrofuran-2-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1S)-1-[(2R)-4-prop-1-en-2-yl-2,5-dihydrofuran-2-yl]ethoxy]silane |
|---|---|
| PubChem CID | 12990077 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | tert-butyl-dimethyl-[(1S)-1-[(2R)-4-prop-1-en-2-yl-2,5-dihydrofuran-2-yl]ethoxy]silane |
| SMILES | C=C(C)C1=C[C@H]([C@H](C)O[Si](C)(C)C(C)(C)C)OC1 |
| InChI | InChI=1S/C15H28O2Si/c1-11(2)13-9-14(16-10-13)12(3)17-18(7,8)15(4,5)6/h9,12,14H,1,10H2,2-8H3/t12-,14+/m0/s1 |
| InChIKey | CHUODYBOSCJESN-GXTWGEPZSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|