C20H23NO5 — CID 12991019
(1S,2S,3R,8S,9R,13R)-11,11-dimethyl-7-methylidene-3-phenylmethoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one (PubChem CID 12991019) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is (1S,2S,3R,8S,9R,13R)-11,11-dimethyl-7-methylidene-3-phenylmethoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one.
| Compound Name | (1S,2S,3R,8S,9R,13R)-11,11-dimethyl-7-methylidene-3-phenylmethoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one |
|---|---|
| PubChem CID | 12991019 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (1S,2S,3R,8S,9R,13R)-11,11-dimethyl-7-methylidene-3-phenylmethoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one |
| SMILES | C=C1CN2C(=O)[C@H](OCc3ccccc3)[C@@H]2[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C20H23NO5/c1-11-9-21-14(15-13(11)16-19(24-15)26-20(2,3)25-16)17(18(21)22)23-10-12-7-5-4-6-8-12/h4-8,13-17,19H,1,9-10H2,2-3H3/t13-,14-,15-,16+,17+,19+/m0/s1 |
| InChIKey | NOAKGSRFRQWTEC-SQZHQNNWSA-N |
| XLogP | 1.85 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|