C19H21NO5 — CID 12991018
(1S,2S,3R,8S,9R,13R)-11,11-dimethyl-7-methylidene-3-phenoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one (PubChem CID 12991018) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (1S,2S,3R,8S,9R,13R)-11,11-dimethyl-7-methylidene-3-phenoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one.
| Compound Name | (1S,2S,3R,8S,9R,13R)-11,11-dimethyl-7-methylidene-3-phenoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one |
|---|---|
| PubChem CID | 12991018 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (1S,2S,3R,8S,9R,13R)-11,11-dimethyl-7-methylidene-3-phenoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one |
| SMILES | C=C1CN2C(=O)[C@H](Oc3ccccc3)[C@@H]2[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C19H21NO5/c1-10-9-20-13(16(17(20)21)22-11-7-5-4-6-8-11)14-12(10)15-18(23-14)25-19(2,3)24-15/h4-8,12-16,18H,1,9H2,2-3H3/t12-,13-,14-,15+,16+,18+/m0/s1 |
| InChIKey | IJFZPEYBVQJRAF-VVHNNWHFSA-N |
| XLogP | 1.71 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|