C19H20INO5 — CID 12992166
(3R,4R)-4-[(3aR,5R,6R,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxy-1-prop-2-ynylazetidin-2-one (PubChem CID 12992166) has the molecular formula C19H20INO5 and a molecular weight of 469.28 g/mol. Its IUPAC name is (3R,4R)-4-[(3aR,5R,6R,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxy-1-prop-2-ynylazetidin-2-one.
| Compound Name | (3R,4R)-4-[(3aR,5R,6R,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxy-1-prop-2-ynylazetidin-2-one |
|---|---|
| PubChem CID | 12992166 |
| Molecular Formula | C19H20INO5 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | (3R,4R)-4-[(3aR,5R,6R,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxy-1-prop-2-ynylazetidin-2-one |
| SMILES | C#CCN1C(=O)[C@H](Oc2ccccc2)[C@@H]1[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1I |
| InChI | InChI=1S/C19H20INO5/c1-4-10-21-13(16(17(21)22)23-11-8-6-5-7-9-11)14-12(20)15-18(24-14)26-19(2,3)25-15/h1,5-9,12-16,18H,10H2,2-3H3/t12-,13+,14+,15-,16-,18-/m1/s1 |
| InChIKey | WUYZUSRKDLUGNR-FFZGVQJCSA-N |
| XLogP | 1.96 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|