C20H25NO4 — CID 10521326
(3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hex-5-ynyl-3-phenoxyazetidin-2-one (PubChem CID 10521326) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hex-5-ynyl-3-phenoxyazetidin-2-one.
| Compound Name | (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hex-5-ynyl-3-phenoxyazetidin-2-one |
|---|---|
| PubChem CID | 10521326 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hex-5-ynyl-3-phenoxyazetidin-2-one |
| SMILES | C#CCCCCN1C(=O)[C@H](Oc2ccccc2)[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H25NO4/c1-4-5-6-10-13-21-17(16-14-23-20(2,3)25-16)18(19(21)22)24-15-11-8-7-9-12-15/h1,7-9,11-12,16-18H,5-6,10,13-14H2,2-3H3/t16-,17+,18-/m1/s1 |
| InChIKey | WTKSAZAWPJNZSI-FGTMMUONSA-N |
| XLogP | 2.60 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|