C18H21NO4 — CID 11034403
(3R,4S)-1-but-3-ynyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenoxyazetidin-2-one (PubChem CID 11034403) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (3R,4S)-1-but-3-ynyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenoxyazetidin-2-one.
| Compound Name | (3R,4S)-1-but-3-ynyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenoxyazetidin-2-one |
|---|---|
| PubChem CID | 11034403 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (3R,4S)-1-but-3-ynyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenoxyazetidin-2-one |
| SMILES | C#CCCN1C(=O)[C@H](Oc2ccccc2)[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H21NO4/c1-4-5-11-19-15(14-12-21-18(2,3)23-14)16(17(19)20)22-13-9-7-6-8-10-13/h1,6-10,14-16H,5,11-12H2,2-3H3/t14-,15+,16-/m1/s1 |
| InChIKey | UDXCXGMBCIQKPA-OWCLPIDISA-N |
| XLogP | 1.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|