C19H21NO5 — CID 12992162
(1S,2R,3S,9S,10R,14R)-12,12-dimethyl-3-phenoxy-11,13,15-trioxa-5-azatetracyclo[7.6.0.02,5.010,14]pentadec-7-en-4-one (PubChem CID 12992162) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (1S,2R,3S,9S,10R,14R)-12,12-dimethyl-3-phenoxy-11,13,15-trioxa-5-azatetracyclo[7.6.0.02,5.010,14]pentadec-7-en-4-one.
| Compound Name | (1S,2R,3S,9S,10R,14R)-12,12-dimethyl-3-phenoxy-11,13,15-trioxa-5-azatetracyclo[7.6.0.02,5.010,14]pentadec-7-en-4-one |
|---|---|
| PubChem CID | 12992162 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (1S,2R,3S,9S,10R,14R)-12,12-dimethyl-3-phenoxy-11,13,15-trioxa-5-azatetracyclo[7.6.0.02,5.010,14]pentadec-7-en-4-one |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](C=CCN4C(=O)[C@@H](Oc5ccccc5)[C@@H]34)[C@H]2O1 |
| InChI | InChI=1S/C19H21NO5/c1-19(2)24-15-12-9-6-10-20-13(14(12)23-18(15)25-19)16(17(20)21)22-11-7-4-3-5-8-11/h3-9,12-16,18H,10H2,1-2H3/t12-,13+,14-,15+,16-,18+/m0/s1 |
| InChIKey | LZVVHVIAYBQHSO-ICELYOSQSA-N |
| XLogP | 1.71 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|