C8H14O2S — CID 12992189
(2S,5S)-2-methyl-1,10-dioxa-4-thiaspiro[4.5]decane (PubChem CID 12992189) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is (2S,5S)-2-methyl-1,10-dioxa-4-thiaspiro[4.5]decane.
| Compound Name | (2S,5S)-2-methyl-1,10-dioxa-4-thiaspiro[4.5]decane |
|---|---|
| PubChem CID | 12992189 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (2S,5S)-2-methyl-1,10-dioxa-4-thiaspiro[4.5]decane |
| SMILES | C[C@H]1CS[C@]2(CCCCO2)O1 |
| InChI | InChI=1S/C8H14O2S/c1-7-6-11-8(10-7)4-2-3-5-9-8/h7H,2-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | DHUUUFAKAJLZLB-YUMQZZPRSA-N |
| XLogP | 1.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |