C20H30O2 — CID 12992274
3,3-dibutyl-2-ethyl-2-hydroxy-4H-naphthalen-1-one (PubChem CID 12992274) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 3,3-dibutyl-2-ethyl-2-hydroxy-4H-naphthalen-1-one.
| Compound Name | 3,3-dibutyl-2-ethyl-2-hydroxy-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 12992274 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 3,3-dibutyl-2-ethyl-2-hydroxy-4H-naphthalen-1-one |
| SMILES | CCCCC1(CCCC)Cc2ccccc2C(=O)C1(O)CC |
| InChI | InChI=1S/C20H30O2/c1-4-7-13-19(14-8-5-2)15-16-11-9-10-12-17(16)18(21)20(19,22)6-3/h9-12,22H,4-8,13-15H2,1-3H3 |
| InChIKey | QMRYGDWCHXAZDU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |