C22H16N4O3S — CID 12993030
3-(1,3-benzodioxol-5-yl)-2-(imidazole-1-carbothioyl)-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one (PubChem CID 12993030) has the molecular formula C22H16N4O3S and a molecular weight of 416.46 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-(imidazole-1-carbothioyl)-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-(imidazole-1-carbothioyl)-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one |
|---|---|
| PubChem CID | 12993030 |
| Molecular Formula | C22H16N4O3S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-(imidazole-1-carbothioyl)-3,4-dihydro-1H-pyrrolo[3,4-b]quinolin-9-one |
| SMILES | O=c1c2c([nH]c3ccccc13)C(c1ccc3c(c1)OCO3)N(C(=S)n1ccnc1)C2 |
| InChI | InChI=1S/C22H16N4O3S/c27-21-14-3-1-2-4-16(14)24-19-15(21)10-26(22(30)25-8-7-23-11-25)20(19)13-5-6-17-18(9-13)29-12-28-17/h1-9,11,20H,10,12H2,(H,24,27) |
| InChIKey | YDPMNOXHNRTSNS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|