C28H20N6S2 — CID 12994963
2-[(4-anilinoquinazolin-2-yl)disulfanyl]-N-phenylquinazolin-4-amine (PubChem CID 12994963) has the molecular formula C28H20N6S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 2-[(4-anilinoquinazolin-2-yl)disulfanyl]-N-phenylquinazolin-4-amine.
| Compound Name | 2-[(4-anilinoquinazolin-2-yl)disulfanyl]-N-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 12994963 |
| Molecular Formula | C28H20N6S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 2-[(4-anilinoquinazolin-2-yl)disulfanyl]-N-phenylquinazolin-4-amine |
| SMILES | c1ccc(Nc2nc(SSc3nc(Nc4ccccc4)c4ccccc4n3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C28H20N6S2/c1-3-11-19(12-4-1)29-25-21-15-7-9-17-23(21)31-27(33-25)35-36-28-32-24-18-10-8-16-22(24)26(34-28)30-20-13-5-2-6-14-20/h1-18H,(H,29,31,33)(H,30,32,34) |
| InChIKey | WJVOYHNMRHEHAS-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|