C20H16N4OS — CID 175453363
S-[4-(4-cyanoanilino)quinazolin-2-yl] cyclobutanecarbothioate (PubChem CID 175453363) has the molecular formula C20H16N4OS and a molecular weight of 360.44 g/mol. Its IUPAC name is S-[4-(4-cyanoanilino)quinazolin-2-yl] cyclobutanecarbothioate.
| Compound Name | S-[4-(4-cyanoanilino)quinazolin-2-yl] cyclobutanecarbothioate |
|---|---|
| PubChem CID | 175453363 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | S-[4-(4-cyanoanilino)quinazolin-2-yl] cyclobutanecarbothioate |
| SMILES | N#Cc1ccc(Nc2nc(SC(=O)C3CCC3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C20H16N4OS/c21-12-13-8-10-15(11-9-13)22-18-16-6-1-2-7-17(16)23-20(24-18)26-19(25)14-4-3-5-14/h1-2,6-11,14H,3-5H2,(H,22,23,24) |
| InChIKey | NNLGRDBVPUYNIE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|