About methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate
methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate (PubChem CID 175453328) has the molecular formula C20H18N4O4S
and a molecular weight of 410.46 g/mol. Its IUPAC name is methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate.
Molecular Properties
| Compound Name | methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate |
| PubChem CID | 175453328 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSc1nc(Nc2ccc(C#N)cc2)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C20H18N4O4S/c1-26-16-8-14-15(9-17(16)27-2)23-20(29-11-18(25)28-3)24-19(14)22-13-6-4-12(10-21)5-7-13/h4-9H,11H2,1-3H3,(H,22,23,24) |
| InChIKey | UFKPANUWJDAYGI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate?
The IUPAC name of methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate (CID 175453328) is methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate.
What is the SMILES notation for methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate?
The canonical SMILES for methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate is COC(=O)CSc1nc(Nc2ccc(C#N)cc2)c2cc(OC)c(OC)cc2n1.
What is the InChIKey of methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate?
The InChIKey is UFKPANUWJDAYGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O4S/c1-26-16-8-14-15(9-17(16)27-2)23-20(29-11-18(25)28-3)24-19(14)22-13-6-4-12(10-21)5-7-13/h4-9H,11H2,1-3H3,(H,22,23,24).
What are the key properties of methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate?
methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate has a molecular weight of 410.46 g/mol, XLogP of 3.53, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(4-cyanoanilino)-6,7-dimethoxyquinazolin-2-yl]sulfanylacetate is sourced from PubChem (CID 175453328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).