C15H14N2O4S — CID 1450792
methyl 2-(3-cyano-6,7-dimethoxyquinolin-2-yl)sulfanylacetate (PubChem CID 1450792) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is methyl 2-(3-cyano-6,7-dimethoxyquinolin-2-yl)sulfanylacetate.
| Compound Name | methyl 2-(3-cyano-6,7-dimethoxyquinolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 1450792 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | methyl 2-(3-cyano-6,7-dimethoxyquinolin-2-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1nc2cc(OC)c(OC)cc2cc1C#N |
| InChI | InChI=1S/C15H14N2O4S/c1-19-12-5-9-4-10(7-16)15(22-8-14(18)21-3)17-11(9)6-13(12)20-2/h4-6H,8H2,1-3H3 |
| InChIKey | VNNQRXNGDYADDO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |