C16H16N2O2S — CID 3207602
methyl 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetate (PubChem CID 3207602) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is methyl 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetate.
| Compound Name | methyl 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 3207602 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | methyl 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1nc2ccc(C(C)C)cc2cc1C#N |
| InChI | InChI=1S/C16H16N2O2S/c1-10(2)11-4-5-14-12(6-11)7-13(8-17)16(18-14)21-9-15(19)20-3/h4-7,10H,9H2,1-3H3 |
| InChIKey | AFSWKERCMJVEOD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |